C8H14F2O — CID 138375711
(Z)-3,8-difluorooct-2-en-1-ol (PubChem CID 138375711) has the molecular formula C8H14F2O and a molecular weight of 164.20 g/mol. Its IUPAC name is (Z)-3,8-difluorooct-2-en-1-ol.
| Compound Name | (Z)-3,8-difluorooct-2-en-1-ol |
|---|---|
| PubChem CID | 138375711 |
| Molecular Formula | C8H14F2O |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | (Z)-3,8-difluorooct-2-en-1-ol |
| SMILES | OC/C=C(\F)CCCCCF |
| InChI | InChI=1S/C8H14F2O/c9-6-3-1-2-4-8(10)5-7-11/h5,11H,1-4,6-7H2/b8-5- |
| InChIKey | CAFVCMGHHDCBPX-YVMONPNESA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|