C13H15N4O3P — CID 138377059
2-[4-[[ethoxy(methyl)phosphoryl]oxymethyl]triazol-1-yl]benzonitrile (PubChem CID 138377059) has the molecular formula C13H15N4O3P and a molecular weight of 306.26 g/mol. Its IUPAC name is 2-[4-[[ethoxy(methyl)phosphoryl]oxymethyl]triazol-1-yl]benzonitrile.
| Compound Name | 2-[4-[[ethoxy(methyl)phosphoryl]oxymethyl]triazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 138377059 |
| Molecular Formula | C13H15N4O3P |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-[4-[[ethoxy(methyl)phosphoryl]oxymethyl]triazol-1-yl]benzonitrile |
| SMILES | CCOP(C)(=O)OCc1cn(-c2ccccc2C#N)nn1 |
| InChI | InChI=1S/C13H15N4O3P/c1-3-19-21(2,18)20-10-12-9-17(16-15-12)13-7-5-4-6-11(13)8-14/h4-7,9H,3,10H2,1-2H3 |
| InChIKey | SDCXRTCARNPRNH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|