About 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile
2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile (PubChem CID 167961941) has the molecular formula C15H16N4O3S
and a molecular weight of 332.39 g/mol. Its IUPAC name is 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile.
Molecular Properties
| Compound Name | 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile |
| PubChem CID | 167961941 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile |
| SMILES | CC1(Cn2cc(COc3ccccc3C#N)nn2)CS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16N4O3S/c1-15(10-23(20,21)11-15)9-19-7-13(17-18-19)8-22-14-5-3-2-4-12(14)6-16/h2-5,7H,8-11H2,1H3 |
| InChIKey | ARJIUHZLPNBGIS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile?
The IUPAC name of 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile (CID 167961941) is 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile.
What is the SMILES notation for 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile?
The canonical SMILES for 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile is CC1(Cn2cc(COc3ccccc3C#N)nn2)CS(=O)(=O)C1.
What is the InChIKey of 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile?
The InChIKey is ARJIUHZLPNBGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3S/c1-15(10-23(20,21)11-15)9-19-7-13(17-18-19)8-22-14-5-3-2-4-12(14)6-16/h2-5,7H,8-11H2,1H3.
What are the key properties of 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile?
2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile has a molecular weight of 332.39 g/mol, XLogP of 1.16, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-[(3-methyl-1,1-dioxothietan-3-yl)methyl]triazol-4-yl]methoxy]benzonitrile is sourced from PubChem (CID 167961941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).