C19H24FN3O4S — CID 138378496
[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(3-fluorophenyl)sulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 138378496) has the molecular formula C19H24FN3O4S and a molecular weight of 409.48 g/mol. Its IUPAC name is [2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(3-fluorophenyl)sulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(3-fluorophenyl)sulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 138378496 |
| Molecular Formula | C19H24FN3O4S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(3-fluorophenyl)sulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | Cc1noc(C)c1CN1CC2CN(S(=O)(=O)c3cccc(F)c3)CC2(CO)C1 |
| InChI | InChI=1S/C19H24FN3O4S/c1-13-18(14(2)27-21-13)9-22-7-15-8-23(11-19(15,10-22)12-24)28(25,26)17-5-3-4-16(20)6-17/h3-6,15,24H,7-12H2,1-2H3 |
| InChIKey | RPPQEMLKSRVHQB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |