C18H25N5O3S — CID 164699735
[(3aS,6aS)-5-(4-methylphenyl)sulfonyl-2-[2-(1,2,4-triazol-4-yl)ethyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 164699735) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is [(3aS,6aS)-5-(4-methylphenyl)sulfonyl-2-[2-(1,2,4-triazol-4-yl)ethyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,6aS)-5-(4-methylphenyl)sulfonyl-2-[2-(1,2,4-triazol-4-yl)ethyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 164699735 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | [(3aS,6aS)-5-(4-methylphenyl)sulfonyl-2-[2-(1,2,4-triazol-4-yl)ethyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3CN(CCn4cnnc4)C[C@]3(CO)C2)cc1 |
| InChI | InChI=1S/C18H25N5O3S/c1-15-2-4-17(5-3-15)27(25,26)23-9-16-8-21(10-18(16,11-23)12-24)6-7-22-13-19-20-14-22/h2-5,13-14,16,24H,6-12H2,1H3/t16-,18+/m0/s1 |
| InChIKey | YRSLRDARHJRXPM-FUHWJXTLSA-N |
| XLogP | 0.20 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |