4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid

C16H22N2O4 — CID 138385702

IUPAC4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid
SMILESO=C(O)C1COCCN(C(=O)CCCCc2cccnc2)C1
InChIInChI=1S/C16H22N2O4/c19-15(6-2-1-4-13-5-3-7-17-10-13)18-8-9-22-12-14(11-18)16(20)21/h3,5,7,10,14H,1-2,4,6,8-9,11-12H2,(H,20,21)
InChIKeyZWYSKYRVVAGCJJ-UHFFFAOYSA-N
MW306.36 g/mol
LogP1.35
Rot. Bonds6

About 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid

4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid (PubChem CID 138385702) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid.

Molecular Properties

Compound Name4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid
PubChem CID138385702
Molecular FormulaC16H22N2O4
Molecular Weight306.36 g/mol
Exact Mass306.16
IUPAC Name4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid
SMILESO=C(O)C1COCCN(C(=O)CCCCc2cccnc2)C1
InChIInChI=1S/C16H22N2O4/c19-15(6-2-1-4-13-5-3-7-17-10-13)18-8-9-22-12-14(11-18)16(20)21/h3,5,7,10,14H,1-2,4,6,8-9,11-12H2,(H,20,21)
InChIKeyZWYSKYRVVAGCJJ-UHFFFAOYSA-N
XLogP1.35
TPSA79.73 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.36
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid?
The IUPAC name of 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid (CID 138385702) is 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid.
What is the SMILES notation for 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid?
The canonical SMILES for 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid is O=C(O)C1COCCN(C(=O)CCCCc2cccnc2)C1.
What is the InChIKey of 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid?
The InChIKey is ZWYSKYRVVAGCJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O4/c19-15(6-2-1-4-13-5-3-7-17-10-13)18-8-9-22-12-14(11-18)16(20)21/h3,5,7,10,14H,1-2,4,6,8-9,11-12H2,(H,20,21).
What are the key properties of 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid?
4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid has a molecular weight of 306.36 g/mol, XLogP of 1.35, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-pyridin-3-ylpentanoyl)-1,4-oxazepane-6-carboxylic acid is sourced from PubChem (CID 138385702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).