C22H33N3O3 — CID 172667022
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-pyridin-3-ylpentan-1-one (PubChem CID 172667022) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-pyridin-3-ylpentan-1-one.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-pyridin-3-ylpentan-1-one |
|---|---|
| PubChem CID | 172667022 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-pyridin-3-ylpentan-1-one |
| SMILES | O=C(CCCCc1cccnc1)N1C[C@H]2C[C@@H](N3CCOCC3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C22H33N3O3/c26-21-13-19-16-25(15-18(19)12-20(21)24-8-10-28-11-9-24)22(27)6-2-1-4-17-5-3-7-23-14-17/h3,5,7,14,18-21,26H,1-2,4,6,8-13,15-16H2/t18-,19+,20-,21-/m1/s1 |
| InChIKey | CDLSBQMGWQRDPI-PLACYPQZSA-N |
| XLogP | 1.72 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|