C25H29ClN4O3 — CID 171697564
(1R,3S,5R)-N-(3-chloro-4-morpholin-4-ylphenyl)-2-(4-pyridin-3-ylbutanoyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 171697564) has the molecular formula C25H29ClN4O3 and a molecular weight of 468.99 g/mol. Its IUPAC name is (1R,3S,5R)-N-(3-chloro-4-morpholin-4-ylphenyl)-2-(4-pyridin-3-ylbutanoyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5R)-N-(3-chloro-4-morpholin-4-ylphenyl)-2-(4-pyridin-3-ylbutanoyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 171697564 |
| Molecular Formula | C25H29ClN4O3 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (1R,3S,5R)-N-(3-chloro-4-morpholin-4-ylphenyl)-2-(4-pyridin-3-ylbutanoyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(Cl)c1)[C@@H]1C[C@H]2C[C@H]2N1C(=O)CCCc1cccnc1 |
| InChI | InChI=1S/C25H29ClN4O3/c26-20-15-19(6-7-21(20)29-9-11-33-12-10-29)28-25(32)23-14-18-13-22(18)30(23)24(31)5-1-3-17-4-2-8-27-16-17/h2,4,6-8,15-16,18,22-23H,1,3,5,9-14H2,(H,28,32)/t18-,22-,23+/m1/s1 |
| InChIKey | CZAGFABTUOQILC-YSZBQJHXSA-N |
| XLogP | 3.52 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|