C19H28N4O2 — CID 172659530
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-pyrazin-2-ylpropan-1-one (PubChem CID 172659530) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-pyrazin-2-ylpropan-1-one.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-pyrazin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 172659530 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-pyrazin-2-ylpropan-1-one |
| SMILES | O=C(CCc1cnccn1)N1C[C@H]2C[C@@H](N3CCCC3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C19H28N4O2/c24-18-10-15-13-23(19(25)4-3-16-11-20-5-6-21-16)12-14(15)9-17(18)22-7-1-2-8-22/h5-6,11,14-15,17-18,24H,1-4,7-10,12-13H2/t14-,15+,17-,18-/m1/s1 |
| InChIKey | IBOCODXUDDEQPA-CYGHRXIMSA-N |
| XLogP | 1.10 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |