C11H19N3OS — CID 138389733
4-imino-10-methyl-1-propan-2-yl-9-thia-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 138389733) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 4-imino-10-methyl-1-propan-2-yl-9-thia-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 4-imino-10-methyl-1-propan-2-yl-9-thia-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138389733 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-imino-10-methyl-1-propan-2-yl-9-thia-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C(C)C)C12CCCSC2C |
| InChI | InChI=1S/C11H19N3OS/c1-7(2)14-10(15)13-9(12)11(14)5-4-6-16-8(11)3/h7-8H,4-6H2,1-3H3,(H2,12,13,15) |
| InChIKey | PFOFCTAZJCREQC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|