C14H26N4O — CID 138390411
4-imino-1-propan-2-yl-9-propyl-1,3,9-triazaspiro[4.6]undecan-2-one (PubChem CID 138390411) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 4-imino-1-propan-2-yl-9-propyl-1,3,9-triazaspiro[4.6]undecan-2-one.
| Compound Name | 4-imino-1-propan-2-yl-9-propyl-1,3,9-triazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 138390411 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 4-imino-1-propan-2-yl-9-propyl-1,3,9-triazaspiro[4.6]undecan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C(C)C)C12CCCN(CCC)CC2 |
| InChI | InChI=1S/C14H26N4O/c1-4-8-17-9-5-6-14(7-10-17)12(15)16-13(19)18(14)11(2)3/h11H,4-10H2,1-3H3,(H2,15,16,19) |
| InChIKey | YTYJOLNTNGTPDX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|