C19H25N5O3 — CID 138391933
tert-butyl 4-(8-methyl-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,9,11-tetraen-11-yl)piperidine-1-carboxylate (PubChem CID 138391933) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is tert-butyl 4-(8-methyl-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,9,11-tetraen-11-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(8-methyl-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,9,11-tetraen-11-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138391933 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | tert-butyl 4-(8-methyl-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,9,11-tetraen-11-yl)piperidine-1-carboxylate |
| SMILES | Cn1c2c[nH]cc2c(=O)n2nc(C3CCN(C(=O)OC(C)(C)C)CC3)cc12 |
| InChI | InChI=1S/C19H25N5O3/c1-19(2,3)27-18(26)23-7-5-12(6-8-23)14-9-16-22(4)15-11-20-10-13(15)17(25)24(16)21-14/h9-12,20H,5-8H2,1-4H3 |
| InChIKey | NRQJNLXXSQTGGE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |