C17H16N2O4S2 — CID 138392121
5-(4-methylphenyl)sulfonyl-4-methylsulfonyl-2-phenyl-1H-imidazole (PubChem CID 138392121) has the molecular formula C17H16N2O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-4-methylsulfonyl-2-phenyl-1H-imidazole.
| Compound Name | 5-(4-methylphenyl)sulfonyl-4-methylsulfonyl-2-phenyl-1H-imidazole |
|---|---|
| PubChem CID | 138392121 |
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-4-methylsulfonyl-2-phenyl-1H-imidazole |
| SMILES | Cc1ccc(S(=O)(=O)c2[nH]c(-c3ccccc3)nc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H16N2O4S2/c1-12-8-10-14(11-9-12)25(22,23)17-16(24(2,20)21)18-15(19-17)13-6-4-3-5-7-13/h3-11H,1-2H3,(H,18,19) |
| InChIKey | LFEAVZROKRALKY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |