C30H46N5O3+ — CID 138393421
(2R,3S,5R)-5-[6-amino-1-[(E)-5-[(1R,2S,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]purin-1-ium-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 138393421) has the molecular formula C30H46N5O3+ and a molecular weight of 524.73 g/mol. Its IUPAC name is (2R,3S,5R)-5-[6-amino-1-[(E)-5-[(1R,2S,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]purin-1-ium-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[6-amino-1-[(E)-5-[(1R,2S,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]purin-1-ium-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 138393421 |
| Molecular Formula | C30H46N5O3+ |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | (2R,3S,5R)-5-[6-amino-1-[(E)-5-[(1R,2S,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]purin-1-ium-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C/C(=C\C[n+]1cnc2c(ncn2[C@H]2C[C@H](O)[C@@H](CO)O2)c1N)CC[C@@]1(C)[C@@H]2CCCC(C)(C)C2=CC[C@@H]1C |
| InChI | InChI=1S/C30H45N5O3/c1-19(10-13-30(5)20(2)8-9-21-22(30)7-6-12-29(21,3)4)11-14-34-17-33-28-26(27(34)31)32-18-35(28)25-15-23(37)24(16-36)38-25/h9,11,17-18,20,22-25,31,36-37H,6-8,10,12-16H2,1-5H3/p+1/b19-11+/t20-,22+,23-,24+,25+,30+/m0/s1 |
| InChIKey | KSGMHEVZRHFJKN-QASAKULJSA-O |
| XLogP | 4.47 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|