C25H36N4O4 — CID 123422169
9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)purin-6-one (PubChem CID 123422169) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is 9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)purin-6-one.
| Compound Name | 9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)purin-6-one |
|---|---|
| PubChem CID | 123422169 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)purin-6-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCn1cnc2c(ncn2C2CC(O)C(CO)O2)c1=O |
| InChI | InChI=1S/C25H36N4O4/c1-17(2)7-5-8-18(3)9-6-10-19(4)11-12-28-15-27-24-23(25(28)32)26-16-29(24)22-13-20(31)21(14-30)33-22/h7,9,11,15-16,20-22,30-31H,5-6,8,10,12-14H2,1-4H3 |
| InChIKey | CDDULECPHUWXMB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|