C11H16IN5O3 — CID 160626765
(2R,3S,5R)-2-(hydroxymethyl)-5-(6-imino-1-methylpurin-9-yl)oxolan-3-ol;hydroiodide (PubChem CID 160626765) has the molecular formula C11H16IN5O3 and a molecular weight of 393.19 g/mol. Its IUPAC name is (2R,3S,5R)-2-(hydroxymethyl)-5-(6-imino-1-methylpurin-9-yl)oxolan-3-ol;hydroiodide.
| Compound Name | (2R,3S,5R)-2-(hydroxymethyl)-5-(6-imino-1-methylpurin-9-yl)oxolan-3-ol;hydroiodide |
|---|---|
| PubChem CID | 160626765 |
| Molecular Formula | C11H16IN5O3 |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | (2R,3S,5R)-2-(hydroxymethyl)-5-(6-imino-1-methylpurin-9-yl)oxolan-3-ol;hydroiodide |
| SMILES | I.[H]/N=c1/c2ncn([C@H]3C[C@H](O)[C@@H](CO)O3)c2ncn1C |
| InChI | InChI=1S/C11H15N5O3.HI/c1-15-4-14-11-9(10(15)12)13-5-16(11)8-2-6(18)7(3-17)19-8;/h4-8,12,17-18H,2-3H2,1H3;1H/b12-10-;/t6-,7+,8+;/m0./s1 |
| InChIKey | RHKCFOLTSDLJJR-UZHPQJCHSA-N |
| XLogP | -0.49 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|