C12H15N6O4+ — CID 10733724
[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methoxypurin-1-ium-6-yl]cyanamide (PubChem CID 10733724) has the molecular formula C12H15N6O4+ and a molecular weight of 310.27 g/mol. Its IUPAC name is [9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methoxypurin-1-ium-6-yl]cyanamide.
| Compound Name | [9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methoxypurin-1-ium-6-yl]cyanamide |
|---|---|
| PubChem CID | 10733724 |
| Molecular Formula | C12H15N6O4+ |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methoxypurin-1-ium-6-yl]cyanamide |
| SMILES | CO[n+]1cnc2c([15n]cn2[C@H]2C[C@H](O)[C@@H](CO)O2)c1[15NH]C#[15N] |
| InChI | InChI=1S/C12H14N6O4/c1-21-18-6-16-11-10(12(18)14-4-13)15-5-17(11)9-2-7(20)8(3-19)22-9/h5-9,19-20H,2-3H2,1H3/p+1/t7-,8+,9+/m0/s1/i13+1,14+1,15+1 |
| InChIKey | VTERNFBAQFHBAA-CXQUTEOBSA-O |
| XLogP | -1.69 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|