C27H44Cl3NO3 — CID 138394081
(Z)-octadec-9-en-1-amine;2-(2,4,5-trichlorophenoxy)propanoic acid (PubChem CID 138394081) has the molecular formula C27H44Cl3NO3 and a molecular weight of 537.01 g/mol. Its IUPAC name is (Z)-octadec-9-en-1-amine;2-(2,4,5-trichlorophenoxy)propanoic acid.
| Compound Name | (Z)-octadec-9-en-1-amine;2-(2,4,5-trichlorophenoxy)propanoic acid |
|---|---|
| PubChem CID | 138394081 |
| Molecular Formula | C27H44Cl3NO3 |
| Molecular Weight | 537.01 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | (Z)-octadec-9-en-1-amine;2-(2,4,5-trichlorophenoxy)propanoic acid |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)O.CCCCCCCC/C=C\CCCCCCCCN |
| InChI | InChI=1S/C18H37N.C9H7Cl3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12/h9-10H,2-8,11-19H2,1H3;2-4H,1H3,(H,13,14)/b10-9-; |
| InChIKey | WNVBVOGKCHSSKD-KVVVOXFISA-N |
| XLogP | 9.48 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.01 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|