About 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide
5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide (PubChem CID 138397177) has the molecular formula C11H28I2N4
and a molecular weight of 470.18 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide.
Molecular Properties
| Compound Name | 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide |
| PubChem CID | 138397177 |
| Molecular Formula | C11H28I2N4 |
| Molecular Weight | 470.18 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide |
| SMILES | CC[N+](C)(CC)CCCCCN=C(N)N.I.[I-] |
| InChI | InChI=1S/C11H27N4.2HI/c1-4-15(3,5-2)10-8-6-7-9-14-11(12)13;;/h4-10H2,1-3H3,(H4,12,13,14);2*1H/q+1;;/p-1 |
| InChIKey | GKJSQWBAKWJJSV-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.18 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide?
The IUPAC name of 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide (CID 138397177) is 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide.
What is the SMILES notation for 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide?
The canonical SMILES for 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide is CC[N+](C)(CC)CCCCCN=C(N)N.I.[I-].
What is the InChIKey of 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide?
The InChIKey is GKJSQWBAKWJJSV-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H27N4.2HI/c1-4-15(3,5-2)10-8-6-7-9-14-11(12)13;;/h4-10H2,1-3H3,(H4,12,13,14);2*1H/q+1;;/p-1.
What are the key properties of 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide?
5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide has a molecular weight of 470.18 g/mol, XLogP of -1.46, 8 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diaminomethylideneamino)pentyl-diethyl-methylazanium;iodide;hydroiodide is sourced from PubChem (CID 138397177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).