About 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide
3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide (PubChem CID 138397463) has the molecular formula C9H24I2N4
and a molecular weight of 442.13 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide.
Molecular Properties
| Compound Name | 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide |
| PubChem CID | 138397463 |
| Molecular Formula | C9H24I2N4 |
| Molecular Weight | 442.13 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide |
| SMILES | CC[N+](C)(CC)CCCN=C(N)N.I.[I-] |
| InChI | InChI=1S/C9H23N4.2HI/c1-4-13(3,5-2)8-6-7-12-9(10)11;;/h4-8H2,1-3H3,(H4,10,11,12);2*1H/q+1;;/p-1 |
| InChIKey | XSHLCNBMAKKSGM-UHFFFAOYSA-M |
| XLogP | -2.24 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.13 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide?
The IUPAC name of 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide (CID 138397463) is 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide.
What is the SMILES notation for 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide?
The canonical SMILES for 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide is CC[N+](C)(CC)CCCN=C(N)N.I.[I-].
What is the InChIKey of 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide?
The InChIKey is XSHLCNBMAKKSGM-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H23N4.2HI/c1-4-13(3,5-2)8-6-7-12-9(10)11;;/h4-8H2,1-3H3,(H4,10,11,12);2*1H/q+1;;/p-1.
What are the key properties of 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide?
3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide has a molecular weight of 442.13 g/mol, XLogP of -2.24, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diaminomethylideneamino)propyl-diethyl-methylazanium;iodide;hydroiodide is sourced from PubChem (CID 138397463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).