C27H51NO6S — CID 138397347
1-[bis(2-hydroxypropyl)amino]propan-2-ol;4-(10-methylundecyl)benzenesulfonic acid (PubChem CID 138397347) has the molecular formula C27H51NO6S and a molecular weight of 517.77 g/mol. Its IUPAC name is 1-[bis(2-hydroxypropyl)amino]propan-2-ol;4-(10-methylundecyl)benzenesulfonic acid.
| Compound Name | 1-[bis(2-hydroxypropyl)amino]propan-2-ol;4-(10-methylundecyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 138397347 |
| Molecular Formula | C27H51NO6S |
| Molecular Weight | 517.77 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | 1-[bis(2-hydroxypropyl)amino]propan-2-ol;4-(10-methylundecyl)benzenesulfonic acid |
| SMILES | CC(C)CCCCCCCCCc1ccc(S(=O)(=O)O)cc1.CC(O)CN(CC(C)O)CC(C)O |
| InChI | InChI=1S/C18H30O3S.C9H21NO3/c1-16(2)10-8-6-4-3-5-7-9-11-17-12-14-18(15-13-17)22(19,20)21;1-7(11)4-10(5-8(2)12)6-9(3)13/h12-16H,3-11H2,1-2H3,(H,19,20,21);7-9,11-13H,4-6H2,1-3H3 |
| InChIKey | WVXIPNBIBZKYLC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|