C10H12IN3O — CID 138398585
1,3-dimethyl-2-(nitrosomethylidene)benzimidazole;hydroiodide (PubChem CID 138398585) has the molecular formula C10H12IN3O and a molecular weight of 317.13 g/mol. Its IUPAC name is 1,3-dimethyl-2-(nitrosomethylidene)benzimidazole;hydroiodide.
| Compound Name | 1,3-dimethyl-2-(nitrosomethylidene)benzimidazole;hydroiodide |
|---|---|
| PubChem CID | 138398585 |
| Molecular Formula | C10H12IN3O |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 1,3-dimethyl-2-(nitrosomethylidene)benzimidazole;hydroiodide |
| SMILES | CN1C(=CN=O)N(C)c2ccccc21.I |
| InChI | InChI=1S/C10H11N3O.HI/c1-12-8-5-3-4-6-9(8)13(2)10(12)7-11-14;/h3-7H,1-2H3;1H |
| InChIKey | OBORQKQMYSJYOQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|