About 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide
2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide (PubChem CID 138399206) has the molecular formula C11H25Br2N3S
and a molecular weight of 391.22 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide |
| PubChem CID | 138399206 |
| Molecular Formula | C11H25Br2N3S |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide |
| SMILES | Br.CC[N+](CC)(CC)CCSC1=NCCN1.[Br-] |
| InChI | InChI=1S/C11H24N3S.2BrH/c1-4-14(5-2,6-3)9-10-15-11-12-7-8-13-11;;/h4-10H2,1-3H3,(H,12,13);2*1H/q+1;;/p-1 |
| InChIKey | VDVUOUADYAMNRG-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide (CID 138399206) is 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide is Br.CC[N+](CC)(CC)CCSC1=NCCN1.[Br-].
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide?
The InChIKey is VDVUOUADYAMNRG-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H24N3S.2BrH/c1-4-14(5-2,6-3)9-10-15-11-12-7-8-13-11;;/h4-10H2,1-3H3,(H,12,13);2*1H/q+1;;/p-1.
What are the key properties of 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide?
2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide has a molecular weight of 391.22 g/mol, XLogP of -0.86, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide is sourced from PubChem (CID 138399206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).