C11H25Br2N3S — CID 138399206
2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide (PubChem CID 138399206) has the molecular formula C11H25Br2N3S and a molecular weight of 391.22 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide.
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide |
|---|---|
| PubChem CID | 138399206 |
| Molecular Formula | C11H25Br2N3S |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)ethyl-triethylazanium;bromide;hydrobromide |
| SMILES | Br.CC[N+](CC)(CC)CCSC1=NCCN1.[Br-] |
| InChI | InChI=1S/C11H24N3S.2BrH/c1-4-14(5-2,6-3)9-10-15-11-12-7-8-13-11;;/h4-10H2,1-3H3,(H,12,13);2*1H/q+1;;/p-1 |
| InChIKey | VDVUOUADYAMNRG-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|