C12H26N2O3SSi — CID 3021675
3-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)propyl-triethoxysilane (PubChem CID 3021675) has the molecular formula C12H26N2O3SSi and a molecular weight of 306.50 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)propyl-triethoxysilane.
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)propyl-triethoxysilane |
|---|---|
| PubChem CID | 3021675 |
| Molecular Formula | C12H26N2O3SSi |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)propyl-triethoxysilane |
| SMILES | CCO[Si](CCCSC1=NCCN1)(OCC)OCC |
| InChI | InChI=1S/C12H26N2O3SSi/c1-4-15-19(16-5-2,17-6-3)11-7-10-18-12-13-8-9-14-12/h4-11H2,1-3H3,(H,13,14) |
| InChIKey | WGJFRXHVORWEHN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|