C9H20N2O3Si — CID 18944736
3-(4,5-dihydro-1H-imidazol-2-yl)propyl-trimethoxysilane (PubChem CID 18944736) has the molecular formula C9H20N2O3Si and a molecular weight of 232.36 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-trimethoxysilane.
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-trimethoxysilane |
|---|---|
| PubChem CID | 18944736 |
| Molecular Formula | C9H20N2O3Si |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)propyl-trimethoxysilane |
| SMILES | CO[Si](CCCC1=NCCN1)(OC)OC |
| InChI | InChI=1S/C9H20N2O3Si/c1-12-15(13-2,14-3)8-4-5-9-10-6-7-11-9/h4-8H2,1-3H3,(H,10,11) |
| InChIKey | ZMOYWJFMTYAQGN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|