C29H27BrN4O2 — CID 138403097
tert-butyl N-[(Z)-[1-(4-bromophenyl)-2,2-bis(1H-indol-3-yl)ethylidene]amino]carbamate (PubChem CID 138403097) has the molecular formula C29H27BrN4O2 and a molecular weight of 543.47 g/mol. Its IUPAC name is tert-butyl N-[(Z)-[1-(4-bromophenyl)-2,2-bis(1H-indol-3-yl)ethylidene]amino]carbamate.
| Compound Name | tert-butyl N-[(Z)-[1-(4-bromophenyl)-2,2-bis(1H-indol-3-yl)ethylidene]amino]carbamate |
|---|---|
| PubChem CID | 138403097 |
| Molecular Formula | C29H27BrN4O2 |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | tert-butyl N-[(Z)-[1-(4-bromophenyl)-2,2-bis(1H-indol-3-yl)ethylidene]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C(\c1ccc(Br)cc1)C(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H27BrN4O2/c1-29(2,3)36-28(35)34-33-27(18-12-14-19(30)15-13-18)26(22-16-31-24-10-6-4-8-20(22)24)23-17-32-25-11-7-5-9-21(23)25/h4-17,26,31-32H,1-3H3,(H,34,35)/b33-27+ |
| InChIKey | OGEQYGLVHLYJKE-MUGXBBEHSA-N |
| XLogP | 7.47 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|