About methanesulfonate;(2-phenylphenyl)azanium
methanesulfonate;(2-phenylphenyl)azanium (PubChem CID 138453494) has the molecular formula C13H15NO3S
and a molecular weight of 265.33 g/mol. Its IUPAC name is methanesulfonate;(2-phenylphenyl)azanium.
Molecular Properties
| Compound Name | methanesulfonate;(2-phenylphenyl)azanium |
| PubChem CID | 138453494 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | methanesulfonate;(2-phenylphenyl)azanium |
| SMILES | CS(=O)(=O)[O-].[NH3+]c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H11N.CH4O3S/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4/h1-9H,13H2;1H3,(H,2,3,4) |
| InChIKey | NONLYMJHKGQHLQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;(2-phenylphenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;(2-phenylphenyl)azanium?
The IUPAC name of methanesulfonate;(2-phenylphenyl)azanium (CID 138453494) is methanesulfonate;(2-phenylphenyl)azanium.
What is the SMILES notation for methanesulfonate;(2-phenylphenyl)azanium?
The canonical SMILES for methanesulfonate;(2-phenylphenyl)azanium is CS(=O)(=O)[O-].[NH3+]c1ccccc1-c1ccccc1.
What is the InChIKey of methanesulfonate;(2-phenylphenyl)azanium?
The InChIKey is NONLYMJHKGQHLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.CH4O3S/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4/h1-9H,13H2;1H3,(H,2,3,4).
What are the key properties of methanesulfonate;(2-phenylphenyl)azanium?
methanesulfonate;(2-phenylphenyl)azanium has a molecular weight of 265.33 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;(2-phenylphenyl)azanium is sourced from PubChem (CID 138453494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).