C28H19FN4O2 — CID 138454654
10-[(4-acetylphenyl)diazenyl]-2-amino-4-(4-fluorophenyl)-4H-benzo[g]chromene-3-carbonitrile (PubChem CID 138454654) has the molecular formula C28H19FN4O2 and a molecular weight of 462.48 g/mol. Its IUPAC name is 10-[(4-acetylphenyl)diazenyl]-2-amino-4-(4-fluorophenyl)-4H-benzo[g]chromene-3-carbonitrile.
| Compound Name | 10-[(4-acetylphenyl)diazenyl]-2-amino-4-(4-fluorophenyl)-4H-benzo[g]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 138454654 |
| Molecular Formula | C28H19FN4O2 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 10-[(4-acetylphenyl)diazenyl]-2-amino-4-(4-fluorophenyl)-4H-benzo[g]chromene-3-carbonitrile |
| SMILES | CC(=O)c1ccc(/N=N/c2c3c(cc4ccccc24)C(c2ccc(F)cc2)C(C#N)=C(N)O3)cc1 |
| InChI | InChI=1S/C28H19FN4O2/c1-16(34)17-8-12-21(13-9-17)32-33-26-22-5-3-2-4-19(22)14-23-25(18-6-10-20(29)11-7-18)24(15-30)28(31)35-27(23)26/h2-14,25H,31H2,1H3/b33-32+ |
| InChIKey | XBLREFBIEFLGJB-ULIFNZDWSA-N |
| XLogP | 6.82 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|