C16H12Br2N4 — CID 138455289
2,5-bis(5-bromo-2-pyridinyl)benzene-1,4-diamine (PubChem CID 138455289) has the molecular formula C16H12Br2N4 and a molecular weight of 420.11 g/mol. Its IUPAC name is 2,5-bis(5-bromo-2-pyridinyl)benzene-1,4-diamine.
| Compound Name | 2,5-bis(5-bromo-2-pyridinyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 138455289 |
| Molecular Formula | C16H12Br2N4 |
| Molecular Weight | 420.11 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | 2,5-bis(5-bromo-2-pyridinyl)benzene-1,4-diamine |
| SMILES | Nc1cc(-c2ccc(Br)cn2)c(N)cc1-c1ccc(Br)cn1 |
| InChI | InChI=1S/C16H12Br2N4/c17-9-1-3-15(21-7-9)11-5-14(20)12(6-13(11)19)16-4-2-10(18)8-22-16/h1-8H,19-20H2 |
| InChIKey | ZRMJPXZYIUBKHY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.11 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|