About 5-bromopyridin-2-amine;hydrochloride
5-bromopyridin-2-amine;hydrochloride (PubChem CID 22615197) has the molecular formula C5H6BrClN2
and a molecular weight of 209.47 g/mol. Its IUPAC name is 5-bromopyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-bromopyridin-2-amine;hydrochloride |
| PubChem CID | 22615197 |
| Molecular Formula | C5H6BrClN2 |
| Molecular Weight | 209.47 g/mol |
| Exact Mass | 207.94 |
| IUPAC Name | 5-bromopyridin-2-amine;hydrochloride |
| SMILES | Cl.Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C5H5BrN2.ClH/c6-4-1-2-5(7)8-3-4;/h1-3H,(H2,7,8);1H |
| InChIKey | BYDKCEPNDUXNLZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromopyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopyridin-2-amine;hydrochloride?
The IUPAC name of 5-bromopyridin-2-amine;hydrochloride (CID 22615197) is 5-bromopyridin-2-amine;hydrochloride.
What is the SMILES notation for 5-bromopyridin-2-amine;hydrochloride?
The canonical SMILES for 5-bromopyridin-2-amine;hydrochloride is Cl.Nc1ccc(Br)cn1.
What is the InChIKey of 5-bromopyridin-2-amine;hydrochloride?
The InChIKey is BYDKCEPNDUXNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN2.ClH/c6-4-1-2-5(7)8-3-4;/h1-3H,(H2,7,8);1H.
What are the key properties of 5-bromopyridin-2-amine;hydrochloride?
5-bromopyridin-2-amine;hydrochloride has a molecular weight of 209.47 g/mol, XLogP of 1.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopyridin-2-amine;hydrochloride is sourced from PubChem (CID 22615197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).