About 5-iodopyridin-2-amine
5-iodopyridin-2-amine (PubChem CID 157150642) has the molecular formula C10H10I2N4
and a molecular weight of 440.03 g/mol. Its IUPAC name is 5-iodopyridin-2-amine.
Molecular Properties
| Compound Name | 5-iodopyridin-2-amine |
| PubChem CID | 157150642 |
| Molecular Formula | C10H10I2N4 |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.90 |
| IUPAC Name | 5-iodopyridin-2-amine |
| SMILES | Nc1ccc(I)cn1.Nc1ccc(I)cn1 |
| InChI | InChI=1S/2C5H5IN2/c2*6-4-1-2-5(7)8-3-4/h2*1-3H,(H2,7,8) |
| InChIKey | ALFHAWDKAUCJLM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodopyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodopyridin-2-amine?
The IUPAC name of 5-iodopyridin-2-amine (CID 157150642) is 5-iodopyridin-2-amine.
What is the SMILES notation for 5-iodopyridin-2-amine?
The canonical SMILES for 5-iodopyridin-2-amine is Nc1ccc(I)cn1.Nc1ccc(I)cn1.
What is the InChIKey of 5-iodopyridin-2-amine?
The InChIKey is ALFHAWDKAUCJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5IN2/c2*6-4-1-2-5(7)8-3-4/h2*1-3H,(H2,7,8).
What are the key properties of 5-iodopyridin-2-amine?
5-iodopyridin-2-amine has a molecular weight of 440.03 g/mol, XLogP of 2.54, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodopyridin-2-amine is sourced from PubChem (CID 157150642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).