C10H5BrF2N2 — CID 139429765
3-(5-bromo-2-pyridinyl)-2,6-difluoropyridine (PubChem CID 139429765) has the molecular formula C10H5BrF2N2 and a molecular weight of 271.06 g/mol. Its IUPAC name is 3-(5-bromo-2-pyridinyl)-2,6-difluoropyridine.
| Compound Name | 3-(5-bromo-2-pyridinyl)-2,6-difluoropyridine |
|---|---|
| PubChem CID | 139429765 |
| Molecular Formula | C10H5BrF2N2 |
| Molecular Weight | 271.06 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 3-(5-bromo-2-pyridinyl)-2,6-difluoropyridine |
| SMILES | Fc1ccc(-c2ccc(Br)cn2)c(F)n1 |
| InChI | InChI=1S/C10H5BrF2N2/c11-6-1-3-8(14-5-6)7-2-4-9(12)15-10(7)13/h1-5H |
| InChIKey | SCQXLPALPYXODM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.06 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|