C16H7BrF4N2 — CID 70974130
3-[3-bromo-5-(2,6-difluoro-3-pyridinyl)phenyl]-2,6-difluoropyridine (PubChem CID 70974130) has the molecular formula C16H7BrF4N2 and a molecular weight of 383.14 g/mol. Its IUPAC name is 3-[3-bromo-5-(2,6-difluoro-3-pyridinyl)phenyl]-2,6-difluoropyridine.
| Compound Name | 3-[3-bromo-5-(2,6-difluoro-3-pyridinyl)phenyl]-2,6-difluoropyridine |
|---|---|
| PubChem CID | 70974130 |
| Molecular Formula | C16H7BrF4N2 |
| Molecular Weight | 383.14 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 3-[3-bromo-5-(2,6-difluoro-3-pyridinyl)phenyl]-2,6-difluoropyridine |
| SMILES | Fc1ccc(-c2cc(Br)cc(-c3ccc(F)nc3F)c2)c(F)n1 |
| InChI | InChI=1S/C16H7BrF4N2/c17-10-6-8(11-1-3-13(18)22-15(11)20)5-9(7-10)12-2-4-14(19)23-16(12)21/h1-7H |
| InChIKey | DDVDUXVPLNVKNQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.14 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|