C30H42N4O7S2 — CID 138455961
5-O-[4-[2,1,3-benzoxadiazole-5-carbonyl(methyl)amino]cyclohexyl] 1-O-[(Z)-3-(butyldisulfanyl)-4-[formyl(methyl)amino]pent-3-enyl] pentanedioate (PubChem CID 138455961) has the molecular formula C30H42N4O7S2 and a molecular weight of 634.82 g/mol. Its IUPAC name is 5-O-[4-[2,1,3-benzoxadiazole-5-carbonyl(methyl)amino]cyclohexyl] 1-O-[(Z)-3-(butyldisulfanyl)-4-[formyl(methyl)amino]pent-3-enyl] pentanedioate.
| Compound Name | 5-O-[4-[2,1,3-benzoxadiazole-5-carbonyl(methyl)amino]cyclohexyl] 1-O-[(Z)-3-(butyldisulfanyl)-4-[formyl(methyl)amino]pent-3-enyl] pentanedioate |
|---|---|
| PubChem CID | 138455961 |
| Molecular Formula | C30H42N4O7S2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | 5-O-[4-[2,1,3-benzoxadiazole-5-carbonyl(methyl)amino]cyclohexyl] 1-O-[(Z)-3-(butyldisulfanyl)-4-[formyl(methyl)amino]pent-3-enyl] pentanedioate |
| SMILES | CCCCSS/C(CCOC(=O)CCCC(=O)OC1CCC(N(C)C(=O)c2ccc3nonc3c2)CC1)=C(/C)N(C)C=O |
| InChI | InChI=1S/C30H42N4O7S2/c1-5-6-18-42-43-27(21(2)33(3)20-35)16-17-39-28(36)8-7-9-29(37)40-24-13-11-23(12-14-24)34(4)30(38)22-10-15-25-26(19-22)32-41-31-25/h10,15,19-20,23-24H,5-9,11-14,16-18H2,1-4H3/b27-21- |
| InChIKey | VPAXLGOWSVNUSD-MEFGMAGPSA-N |
| XLogP | 5.75 |
| TPSA | 132.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|