C30H42N4O6S2 — CID 158248707
5-O-[4-[2H-benzimidazole-5-carbonyl(methyl)amino]cyclohexyl] 1-O-[(Z)-3-(ethyldisulfanyl)-4-[ethyl(formyl)amino]pent-3-enyl] pentanedioate (PubChem CID 158248707) has the molecular formula C30H42N4O6S2 and a molecular weight of 618.82 g/mol. Its IUPAC name is 5-O-[4-[2H-benzimidazole-5-carbonyl(methyl)amino]cyclohexyl] 1-O-[(Z)-3-(ethyldisulfanyl)-4-[ethyl(formyl)amino]pent-3-enyl] pentanedioate.
| Compound Name | 5-O-[4-[2H-benzimidazole-5-carbonyl(methyl)amino]cyclohexyl] 1-O-[(Z)-3-(ethyldisulfanyl)-4-[ethyl(formyl)amino]pent-3-enyl] pentanedioate |
|---|---|
| PubChem CID | 158248707 |
| Molecular Formula | C30H42N4O6S2 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 5-O-[4-[2H-benzimidazole-5-carbonyl(methyl)amino]cyclohexyl] 1-O-[(Z)-3-(ethyldisulfanyl)-4-[ethyl(formyl)amino]pent-3-enyl] pentanedioate |
| SMILES | CCSS/C(CCOC(=O)CCCC(=O)OC1CCC(N(C)C(=O)c2ccc3c(c2)=NCN=3)CC1)=C(/C)N(C=O)CC |
| InChI | InChI=1S/C30H42N4O6S2/c1-5-34(20-35)21(3)27(42-41-6-2)16-17-39-28(36)8-7-9-29(37)40-24-13-11-23(12-14-24)33(4)30(38)22-10-15-25-26(18-22)32-19-31-25/h10,15,18,20,23-24H,5-9,11-14,16-17,19H2,1-4H3/b27-21- |
| InChIKey | IQKQRFVTRNNLSA-MEFGMAGPSA-N |
| XLogP | 4.04 |
| TPSA | 117.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|