C10H17N5 — CID 138457602
(E)-3-[2-(1-methylpyrazol-3-yl)ethylimino]but-1-ene-1,2-diamine (PubChem CID 138457602) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is (E)-3-[2-(1-methylpyrazol-3-yl)ethylimino]but-1-ene-1,2-diamine.
| Compound Name | (E)-3-[2-(1-methylpyrazol-3-yl)ethylimino]but-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 138457602 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | (E)-3-[2-(1-methylpyrazol-3-yl)ethylimino]but-1-ene-1,2-diamine |
| SMILES | CC(=N\CCc1ccn(C)n1)/C(N)=C\N |
| InChI | InChI=1S/C10H17N5/c1-8(10(12)7-11)13-5-3-9-4-6-15(2)14-9/h4,6-7H,3,5,11-12H2,1-2H3/b10-7+,13-8+ |
| InChIKey | SDBBDHNKGFMHMG-OOHIBURESA-N |
| XLogP | 0.18 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|