C10H15N5 — CID 90010529
5-methyl-1-[2-(1-methylpyrazol-3-yl)ethyl]pyrazol-4-amine (PubChem CID 90010529) has the molecular formula C10H15N5 and a molecular weight of 205.27 g/mol. Its IUPAC name is 5-methyl-1-[2-(1-methylpyrazol-3-yl)ethyl]pyrazol-4-amine.
| Compound Name | 5-methyl-1-[2-(1-methylpyrazol-3-yl)ethyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 90010529 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 5-methyl-1-[2-(1-methylpyrazol-3-yl)ethyl]pyrazol-4-amine |
| SMILES | Cc1c(N)cnn1CCc1ccn(C)n1 |
| InChI | InChI=1S/C10H15N5/c1-8-10(11)7-12-15(8)6-4-9-3-5-14(2)13-9/h3,5,7H,4,6,11H2,1-2H3 |
| InChIKey | ZOQMMQLAIHNNNI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |