C25H30F4N2 — CID 138460245
1-[cyclohexyl-(4-fluorophenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 138460245) has the molecular formula C25H30F4N2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 1-[cyclohexyl-(4-fluorophenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[cyclohexyl-(4-fluorophenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 138460245 |
| Molecular Formula | C25H30F4N2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1-[cyclohexyl-(4-fluorophenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | Fc1ccc(C(C2CCCCC2)N2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H30F4N2/c26-23-12-8-21(9-13-23)24(20-4-2-1-3-5-20)31-16-14-30(15-17-31)18-19-6-10-22(11-7-19)25(27,28)29/h6-13,20,24H,1-5,14-18H2 |
| InChIKey | UEGIPNVGDDODOQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |