C26H32O5 — CID 138460840
[5-[(4R)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-4-yl]-2-methoxyphenyl] 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 138460840) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is [5-[(4R)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-4-yl]-2-methoxyphenyl] 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | [5-[(4R)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-4-yl]-2-methoxyphenyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 138460840 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [5-[(4R)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-4-yl]-2-methoxyphenyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | COc1ccc([C@@H]2OCC3COCC32)cc1OC(=O)C(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C26H32O5/c1-16(2)11-18-5-7-19(8-6-18)17(3)26(27)31-24-12-20(9-10-23(24)28-4)25-22-15-29-13-21(22)14-30-25/h5-10,12,16-17,21-22,25H,11,13-15H2,1-4H3/t17?,21?,22?,25-/m0/s1 |
| InChIKey | BPLMEQNGGOPKJN-IJXAZYAVSA-N |
| XLogP | 4.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|