C21H12ClIN4 — CID 138461033
9-[4-chloro-6-(3-iodophenyl)-1,3,5-triazin-2-yl]carbazole (PubChem CID 138461033) has the molecular formula C21H12ClIN4 and a molecular weight of 482.71 g/mol. Its IUPAC name is 9-[4-chloro-6-(3-iodophenyl)-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-chloro-6-(3-iodophenyl)-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 138461033 |
| Molecular Formula | C21H12ClIN4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | 9-[4-chloro-6-(3-iodophenyl)-1,3,5-triazin-2-yl]carbazole |
| SMILES | Clc1nc(-c2cccc(I)c2)nc(-n2c3ccccc3c3ccccc32)n1 |
| InChI | InChI=1S/C21H12ClIN4/c22-20-24-19(13-6-5-7-14(23)12-13)25-21(26-20)27-17-10-3-1-8-15(17)16-9-2-4-11-18(16)27/h1-12H |
| InChIKey | JQJATCRFRYYVFX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|