C19H18ClN3O2 — CID 138465131
2-chloro-N-[[3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-yl]methyl]pyridine-3-carboxamide (PubChem CID 138465131) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 2-chloro-N-[[3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-yl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138465131 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-chloro-N-[[3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-yl]methyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(-c2cc(CNC(=O)c3cccnc3Cl)on2)c(C)c1 |
| InChI | InChI=1S/C19H18ClN3O2/c1-11-7-12(2)17(13(3)8-11)16-9-14(25-23-16)10-22-19(24)15-5-4-6-21-18(15)20/h4-9H,10H2,1-3H3,(H,22,24) |
| InChIKey | ZBUMJBKLERIFDY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|