C38H54O9 — CID 138465879
methyl 2-[2-formyloxy-15-[furan-3-yl(prop-1-en-2-yloxy)methyl]-16-hexan-3-yl-3,5,7,10,15-pentamethyl-9,11,17-trioxahexacyclo[8.6.1.15,8.01,12.03,8.07,12]octadecan-6-yl]acetate (PubChem CID 138465879) has the molecular formula C38H54O9 and a molecular weight of 654.84 g/mol. Its IUPAC name is methyl 2-[2-formyloxy-15-[furan-3-yl(prop-1-en-2-yloxy)methyl]-16-hexan-3-yl-3,5,7,10,15-pentamethyl-9,11,17-trioxahexacyclo[8.6.1.15,8.01,12.03,8.07,12]octadecan-6-yl]acetate.
| Compound Name | methyl 2-[2-formyloxy-15-[furan-3-yl(prop-1-en-2-yloxy)methyl]-16-hexan-3-yl-3,5,7,10,15-pentamethyl-9,11,17-trioxahexacyclo[8.6.1.15,8.01,12.03,8.07,12]octadecan-6-yl]acetate |
|---|---|
| PubChem CID | 138465879 |
| Molecular Formula | C38H54O9 |
| Molecular Weight | 654.84 g/mol |
| Exact Mass | 654.38 |
| IUPAC Name | methyl 2-[2-formyloxy-15-[furan-3-yl(prop-1-en-2-yloxy)methyl]-16-hexan-3-yl-3,5,7,10,15-pentamethyl-9,11,17-trioxahexacyclo[8.6.1.15,8.01,12.03,8.07,12]octadecan-6-yl]acetate |
| SMILES | C=C(C)OC(c1ccoc1)C1(C)CCC23OC4(C)OC2(C1C(CC)CCC)C(OC=O)C1(C)CC2(C)CC1(O4)C3(C)C2CC(=O)OC |
| InChI | InChI=1S/C38H54O9/c1-11-13-24(12-2)28-32(6,29(44-23(3)4)25-14-17-42-19-25)15-16-36-34(8)26(18-27(40)41-10)31(5)20-33(7)30(43-22-39)38(28,36)47-35(9,45-36)46-37(33,34)21-31/h14,17,19,22,24,26,28-30H,3,11-13,15-16,18,20-21H2,1-2,4-10H3 |
| InChIKey | BVCAJNWRKXOTBG-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.84 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|