C16H21F2NO2 — CID 138466386
(2E,4E)-1-[(2R)-2-acetylpyrrolidin-1-yl]-4-(1,1-difluoroethyl)-2-methylhepta-2,4,6-trien-1-one (PubChem CID 138466386) has the molecular formula C16H21F2NO2 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2E,4E)-1-[(2R)-2-acetylpyrrolidin-1-yl]-4-(1,1-difluoroethyl)-2-methylhepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E)-1-[(2R)-2-acetylpyrrolidin-1-yl]-4-(1,1-difluoroethyl)-2-methylhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 138466386 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (2E,4E)-1-[(2R)-2-acetylpyrrolidin-1-yl]-4-(1,1-difluoroethyl)-2-methylhepta-2,4,6-trien-1-one |
| SMILES | C=C/C=C(\C=C(/C)C(=O)N1CCC[C@@H]1C(C)=O)C(C)(F)F |
| InChI | InChI=1S/C16H21F2NO2/c1-5-7-13(16(4,17)18)10-11(2)15(21)19-9-6-8-14(19)12(3)20/h5,7,10,14H,1,6,8-9H2,2-4H3/b11-10+,13-7+/t14-/m1/s1 |
| InChIKey | KORUWJYKSLZKSS-WLHWZSAWSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|