C19H23Cl2N5 — CID 138466405
6-[(3aR)-5-(aminomethyl)-5-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)pyrazin-2-amine (PubChem CID 138466405) has the molecular formula C19H23Cl2N5 and a molecular weight of 392.33 g/mol. Its IUPAC name is 6-[(3aR)-5-(aminomethyl)-5-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)pyrazin-2-amine.
| Compound Name | 6-[(3aR)-5-(aminomethyl)-5-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 138466405 |
| Molecular Formula | C19H23Cl2N5 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 6-[(3aR)-5-(aminomethyl)-5-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)pyrazin-2-amine |
| SMILES | CC1(CN)CC2CN(c3cnc(-c4cccc(Cl)c4Cl)c(N)n3)C[C@@H]2C1 |
| InChI | InChI=1S/C19H23Cl2N5/c1-19(10-22)5-11-8-26(9-12(11)6-19)15-7-24-17(18(23)25-15)13-3-2-4-14(20)16(13)21/h2-4,7,11-12H,5-6,8-10,22H2,1H3,(H2,23,25)/t11-,12?,19?/m0/s1 |
| InChIKey | RSCCVBLUIDDQGC-UHOVJUMYSA-N |
| XLogP | 3.84 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |