C19H24Cl2N4 — CID 142543281
3-(2,3-dichlorophenyl)-6-(5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)pyrazin-2-amine;methane (PubChem CID 142543281) has the molecular formula C19H24Cl2N4 and a molecular weight of 379.34 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-6-(5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)pyrazin-2-amine;methane.
| Compound Name | 3-(2,3-dichlorophenyl)-6-(5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)pyrazin-2-amine;methane |
|---|---|
| PubChem CID | 142543281 |
| Molecular Formula | C19H24Cl2N4 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-6-(5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)pyrazin-2-amine;methane |
| SMILES | C.CC1CC2CN(c3cnc(-c4cccc(Cl)c4Cl)c(N)n3)CC2C1 |
| InChI | InChI=1S/C18H20Cl2N4.CH4/c1-10-5-11-8-24(9-12(11)6-10)15-7-22-17(18(21)23-15)13-3-2-4-14(19)16(13)20;/h2-4,7,10-12H,5-6,8-9H2,1H3,(H2,21,23);1H4 |
| InChIKey | CIQYRHMBIBVANC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |