C26H35BrCl2N10 — CID 157262934
3-bromo-6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrazin-2-amine;3-(2,3-dichlorophenyl)-6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrazin-2-amine (PubChem CID 157262934) has the molecular formula C26H35BrCl2N10 and a molecular weight of 638.45 g/mol. Its IUPAC name is 3-bromo-6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrazin-2-amine;3-(2,3-dichlorophenyl)-6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrazin-2-amine.
| Compound Name | 3-bromo-6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrazin-2-amine;3-(2,3-dichlorophenyl)-6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 157262934 |
| Molecular Formula | C26H35BrCl2N10 |
| Molecular Weight | 638.45 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | 3-bromo-6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]pyrazin-2-amine;3-(2,3-dichlorophenyl)-6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrazin-2-amine |
| SMILES | C[C@@H]1CN(c2cnc(-c3cccc(Cl)c3Cl)c(N)n2)C[C@H](C)N1.C[C@@H]1CN(c2cnc(Br)c(N)n2)C[C@H](C)N1 |
| InChI | InChI=1S/C16H19Cl2N5.C10H16BrN5/c1-9-7-23(8-10(2)21-9)13-6-20-15(16(19)22-13)11-4-3-5-12(17)14(11)18;1-6-4-16(5-7(2)14-6)8-3-13-9(11)10(12)15-8/h3-6,9-10,21H,7-8H2,1-2H3,(H2,19,22);3,6-7,14H,4-5H2,1-2H3,(H2,12,15)/t9-,10+;6-,7+ |
| InChIKey | AXRCDPOSXLAHBS-LOLLVERESA-N |
| XLogP | 4.23 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |