C27H21F7N2O3 — CID 138466431
(1S,3R,5S)-N-[(R)-cyclopropyl-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-2-[3-(2,2,2-trifluoro-1-hydroxyethyl)benzoyl]-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide (PubChem CID 138466431) has the molecular formula C27H21F7N2O3 and a molecular weight of 554.46 g/mol. Its IUPAC name is (1S,3R,5S)-N-[(R)-cyclopropyl-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-2-[3-(2,2,2-trifluoro-1-hydroxyethyl)benzoyl]-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide.
| Compound Name | (1S,3R,5S)-N-[(R)-cyclopropyl-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-2-[3-(2,2,2-trifluoro-1-hydroxyethyl)benzoyl]-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide |
|---|---|
| PubChem CID | 138466431 |
| Molecular Formula | C27H21F7N2O3 |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | (1S,3R,5S)-N-[(R)-cyclopropyl-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-2-[3-(2,2,2-trifluoro-1-hydroxyethyl)benzoyl]-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide |
| SMILES | O=C(N[C@@H](c1ccc(C(F)(F)F)cc1F)C1CC1)[C@H]1C[C@H]2C#C[C@H]2N1C(=O)c1cccc(C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H21F7N2O3/c28-19-12-17(26(29,30)31)7-8-18(19)22(13-4-5-13)35-24(38)21-11-14-6-9-20(14)36(21)25(39)16-3-1-2-15(10-16)23(37)27(32,33)34/h1-3,7-8,10,12-14,20-23,37H,4-5,11H2,(H,35,38)/t14-,20-,21-,22-,23?/m1/s1 |
| InChIKey | FTGYTZUYOCJRNZ-CTXOKVQTSA-N |
| XLogP | 4.92 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|