C26H23ClF2N2O6S — CID 138466345
(1S,3R,5S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-2-[3-(2-hydroxyethylsulfonyl)benzoyl]-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide (PubChem CID 138466345) has the molecular formula C26H23ClF2N2O6S and a molecular weight of 564.99 g/mol. Its IUPAC name is (1S,3R,5S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-2-[3-(2-hydroxyethylsulfonyl)benzoyl]-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide.
| Compound Name | (1S,3R,5S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-2-[3-(2-hydroxyethylsulfonyl)benzoyl]-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide |
|---|---|
| PubChem CID | 138466345 |
| Molecular Formula | C26H23ClF2N2O6S |
| Molecular Weight | 564.99 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | (1S,3R,5S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-(oxetan-3-yl)methyl]-2-[3-(2-hydroxyethylsulfonyl)benzoyl]-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide |
| SMILES | O=C(N[C@@H](c1cc(F)c(Cl)cc1F)C1COC1)[C@H]1C[C@H]2C#C[C@H]2N1C(=O)c1cccc(S(=O)(=O)CCO)c1 |
| InChI | InChI=1S/C26H23ClF2N2O6S/c27-19-11-20(28)18(10-21(19)29)24(16-12-37-13-16)30-25(33)23-9-14-4-5-22(14)31(23)26(34)15-2-1-3-17(8-15)38(35,36)7-6-32/h1-3,8,10-11,14,16,22-24,32H,6-7,9,12-13H2,(H,30,33)/t14-,22-,23-,24-/m1/s1 |
| InChIKey | OHMLYTKLYLUIIM-VBLLFZBCSA-N |
| XLogP | 2.10 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.99 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|