C22H21ClF2N2O4S — CID 138466797
(1R,3R)-N-[(1R)-1-(4-chloro-2,5-difluorophenyl)ethyl]-2-(3-methylsulfonylbenzoyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 138466797) has the molecular formula C22H21ClF2N2O4S and a molecular weight of 482.94 g/mol. Its IUPAC name is (1R,3R)-N-[(1R)-1-(4-chloro-2,5-difluorophenyl)ethyl]-2-(3-methylsulfonylbenzoyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3R)-N-[(1R)-1-(4-chloro-2,5-difluorophenyl)ethyl]-2-(3-methylsulfonylbenzoyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 138466797 |
| Molecular Formula | C22H21ClF2N2O4S |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (1R,3R)-N-[(1R)-1-(4-chloro-2,5-difluorophenyl)ethyl]-2-(3-methylsulfonylbenzoyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@H]1CC2C[C@H]2N1C(=O)c1cccc(S(C)(=O)=O)c1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C22H21ClF2N2O4S/c1-11(15-9-18(25)16(23)10-17(15)24)26-21(28)20-8-13-7-19(13)27(20)22(29)12-4-3-5-14(6-12)32(2,30)31/h3-6,9-11,13,19-20H,7-8H2,1-2H3,(H,26,28)/t11-,13?,19-,20-/m1/s1 |
| InChIKey | CGZKVSMSDQTOTQ-XGPGQVCISA-N |
| XLogP | 3.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|