C22H21ClF2N2O4S — CID 138467038
(2S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-1-(3-methylsulfonylbenzoyl)azetidine-2-carboxamide (PubChem CID 138467038) has the molecular formula C22H21ClF2N2O4S and a molecular weight of 482.94 g/mol. Its IUPAC name is (2S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-1-(3-methylsulfonylbenzoyl)azetidine-2-carboxamide.
| Compound Name | (2S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-1-(3-methylsulfonylbenzoyl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 138467038 |
| Molecular Formula | C22H21ClF2N2O4S |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (2S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-1-(3-methylsulfonylbenzoyl)azetidine-2-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)N2CC[C@H]2C(=O)N[C@@H](c2cc(F)c(Cl)cc2F)C2CC2)c1 |
| InChI | InChI=1S/C22H21ClF2N2O4S/c1-32(30,31)14-4-2-3-13(9-14)22(29)27-8-7-19(27)21(28)26-20(12-5-6-12)15-10-18(25)16(23)11-17(15)24/h2-4,9-12,19-20H,5-8H2,1H3,(H,26,28)/t19-,20+/m0/s1 |
| InChIKey | HXSITBPKKJIKIM-VQTJNVASSA-N |
| XLogP | 3.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|